C29H43N5O4SSi2 — CID 11692964
N-[9-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-yl]benzamide (PubChem CID 11692964) has the molecular formula C29H43N5O4SSi2 and a molecular weight of 613.93 g/mol. Its IUPAC name is N-[9-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 11692964 |
| Molecular Formula | C29H43N5O4SSi2 |
| Molecular Weight | 613.93 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | N-[9-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-yl]benzamide |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2S[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)C[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C29H43N5O4SSi2/c1-18(2)40(19(3)4)36-15-24-23(37-41(38-40,20(5)6)21(7)8)14-25(39-24)34-17-32-26-27(30-16-31-28(26)34)33-29(35)22-12-10-9-11-13-22/h9-13,16-21,23-25H,14-15H2,1-8H3,(H,30,31,33,35)/t23-,24+,25+/m0/s1 |
| InChIKey | GFLFMBQHISQITA-ISJGIBHGSA-N |
| XLogP | 7.04 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.93 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|