C20H38N4O4SSi2 — CID 155642236
1-[(6aR,8S,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-amino-1,3,5-triazin-2-one (PubChem CID 155642236) has the molecular formula C20H38N4O4SSi2 and a molecular weight of 486.79 g/mol. Its IUPAC name is 1-[(6aR,8S,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-amino-1,3,5-triazin-2-one.
| Compound Name | 1-[(6aR,8S,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-amino-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 155642236 |
| Molecular Formula | C20H38N4O4SSi2 |
| Molecular Weight | 486.79 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 1-[(6aR,8S,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-amino-1,3,5-triazin-2-one |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2S[C@H](n3cnc(N)nc3=O)C[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C20H38N4O4SSi2/c1-12(2)30(13(3)4)26-10-17-16(27-31(28-30,14(5)6)15(7)8)9-18(29-17)24-11-22-19(21)23-20(24)25/h11-18H,9-10H2,1-8H3,(H2,21,23,25)/t16-,17+,18-/m0/s1 |
| InChIKey | CJQFGIORHCILFB-KSZLIROESA-N |
| XLogP | 4.18 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.79 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|