C21H37F2N3O5Si2 — CID 90427328
1-[(6aR,9aR)-9,9-difluoro-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-aminopyrimidin-2-one (PubChem CID 90427328) has the molecular formula C21H37F2N3O5Si2 and a molecular weight of 505.71 g/mol. Its IUPAC name is 1-[(6aR,9aR)-9,9-difluoro-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-aminopyrimidin-2-one.
| Compound Name | 1-[(6aR,9aR)-9,9-difluoro-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-aminopyrimidin-2-one |
|---|---|
| PubChem CID | 90427328 |
| Molecular Formula | C21H37F2N3O5Si2 |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 1-[(6aR,9aR)-9,9-difluoro-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-aminopyrimidin-2-one |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2OC(n3ccc(N)nc3=O)C(F)(F)[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C21H37F2N3O5Si2/c1-12(2)32(13(3)4)28-11-16-18(30-33(31-32,14(5)6)15(7)8)21(22,23)19(29-16)26-10-9-17(24)25-20(26)27/h9-10,12-16,18-19H,11H2,1-8H3,(H2,24,25,27)/t16-,18-,19?/m1/s1 |
| InChIKey | RHRXAVMTVDUFFQ-SYUDBMKNSA-N |
| XLogP | 4.31 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|