C16H23F2N4O8P — CID 118391709
propan-2-yl (2S)-2-[[(6aR,8R)-8-(4-amino-2-oxopyrimidin-1-yl)-9,9-difluoro-4-oxo-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2]trioxaphosphocin-4-yl]amino]propanoate (PubChem CID 118391709) has the molecular formula C16H23F2N4O8P and a molecular weight of 468.35 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(6aR,8R)-8-(4-amino-2-oxopyrimidin-1-yl)-9,9-difluoro-4-oxo-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2]trioxaphosphocin-4-yl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[(6aR,8R)-8-(4-amino-2-oxopyrimidin-1-yl)-9,9-difluoro-4-oxo-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2]trioxaphosphocin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 118391709 |
| Molecular Formula | C16H23F2N4O8P |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | propan-2-yl (2S)-2-[[(6aR,8R)-8-(4-amino-2-oxopyrimidin-1-yl)-9,9-difluoro-4-oxo-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2]trioxaphosphocin-4-yl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP1(=O)OCOC2[C@@H](CO1)O[C@@H](n1ccc(N)nc1=O)C2(F)F |
| InChI | InChI=1S/C16H23F2N4O8P/c1-8(2)29-13(23)9(3)21-31(25)27-6-10-12(26-7-28-31)16(17,18)14(30-10)22-5-4-11(19)20-15(22)24/h4-5,8-10,12,14H,6-7H2,1-3H3,(H,21,25)(H2,19,20,24)/t9-,10+,12?,14+,31?/m0/s1 |
| InChIKey | QQEFQAKKGZGDSR-QXORGSOGSA-N |
| XLogP | 0.79 |
| TPSA | 153.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|