C17H27F2N3O4Si — CID 10386460
4-amino-1-(2,2-ditert-butyl-7,7-difluoro-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxasilin-6-yl)pyrimidin-2-one (PubChem CID 10386460) has the molecular formula C17H27F2N3O4Si and a molecular weight of 403.50 g/mol. Its IUPAC name is 4-amino-1-(2,2-ditert-butyl-7,7-difluoro-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxasilin-6-yl)pyrimidin-2-one.
| Compound Name | 4-amino-1-(2,2-ditert-butyl-7,7-difluoro-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxasilin-6-yl)pyrimidin-2-one |
|---|---|
| PubChem CID | 10386460 |
| Molecular Formula | C17H27F2N3O4Si |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 4-amino-1-(2,2-ditert-butyl-7,7-difluoro-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxasilin-6-yl)pyrimidin-2-one |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OCC2OC(n3ccc(N)nc3=O)C(F)(F)C2O1 |
| InChI | InChI=1S/C17H27F2N3O4Si/c1-15(2,3)27(16(4,5)6)24-9-10-12(26-27)17(18,19)13(25-10)22-8-7-11(20)21-14(22)23/h7-8,10,12-13H,9H2,1-6H3,(H2,20,21,23) |
| InChIKey | XTWHFSZAQWZVQU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|