C21H19F2N3O4Si — CID 10026421
4-amino-1-(7,7-difluoro-2,2-diphenyl-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxasilin-6-yl)pyrimidin-2-one (PubChem CID 10026421) has the molecular formula C21H19F2N3O4Si and a molecular weight of 443.48 g/mol. Its IUPAC name is 4-amino-1-(7,7-difluoro-2,2-diphenyl-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxasilin-6-yl)pyrimidin-2-one.
| Compound Name | 4-amino-1-(7,7-difluoro-2,2-diphenyl-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxasilin-6-yl)pyrimidin-2-one |
|---|---|
| PubChem CID | 10026421 |
| Molecular Formula | C21H19F2N3O4Si |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 4-amino-1-(7,7-difluoro-2,2-diphenyl-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxasilin-6-yl)pyrimidin-2-one |
| SMILES | Nc1ccn(C2OC3CO[Si](c4ccccc4)(c4ccccc4)OC3C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C21H19F2N3O4Si/c22-21(23)18-16(29-19(21)26-12-11-17(24)25-20(26)27)13-28-31(30-18,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-12,16,18-19H,13H2,(H2,24,25,27) |
| InChIKey | GXZMRAPZLNPZCZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|