C17H18F2N3O7P — CID 137469436
1-[(4aR,6R,7aR)-7,7-difluoro-2-[(2-methoxyphenyl)methoxy]-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-aminopyrimidin-2-one (PubChem CID 137469436) has the molecular formula C17H18F2N3O7P and a molecular weight of 445.32 g/mol. Its IUPAC name is 1-[(4aR,6R,7aR)-7,7-difluoro-2-[(2-methoxyphenyl)methoxy]-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-aminopyrimidin-2-one.
| Compound Name | 1-[(4aR,6R,7aR)-7,7-difluoro-2-[(2-methoxyphenyl)methoxy]-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-aminopyrimidin-2-one |
|---|---|
| PubChem CID | 137469436 |
| Molecular Formula | C17H18F2N3O7P |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 1-[(4aR,6R,7aR)-7,7-difluoro-2-[(2-methoxyphenyl)methoxy]-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-aminopyrimidin-2-one |
| SMILES | COc1ccccc1COP1(=O)OC[C@H]2O[C@@H](n3ccc(N)nc3=O)C(F)(F)[C@@H]2O1 |
| InChI | InChI=1S/C17H18F2N3O7P/c1-25-11-5-3-2-4-10(11)8-26-30(24)27-9-12-14(29-30)17(18,19)15(28-12)22-7-6-13(20)21-16(22)23/h2-7,12,14-15H,8-9H2,1H3,(H2,20,21,23)/t12-,14-,15-,30?/m1/s1 |
| InChIKey | SMFAGTXFUMVWOR-ZUFGRIELSA-N |
| XLogP | 2.11 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|