C22H29N6O6PS2 — CID 121404673
1-[(4aR,6R,7R,7aS)-7-azido-2-[2-[2-(tert-butyldisulfanyl)phenyl]ethoxy]-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-aminopyrimidin-2-one (PubChem CID 121404673) has the molecular formula C22H29N6O6PS2 and a molecular weight of 568.62 g/mol. Its IUPAC name is 1-[(4aR,6R,7R,7aS)-7-azido-2-[2-[2-(tert-butyldisulfanyl)phenyl]ethoxy]-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-aminopyrimidin-2-one.
| Compound Name | 1-[(4aR,6R,7R,7aS)-7-azido-2-[2-[2-(tert-butyldisulfanyl)phenyl]ethoxy]-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-aminopyrimidin-2-one |
|---|---|
| PubChem CID | 121404673 |
| Molecular Formula | C22H29N6O6PS2 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | 1-[(4aR,6R,7R,7aS)-7-azido-2-[2-[2-(tert-butyldisulfanyl)phenyl]ethoxy]-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-aminopyrimidin-2-one |
| SMILES | CC(C)(C)SSc1ccccc1CCOP1(=O)OC[C@H]2O[C@@H](n3ccc(N)nc3=O)[C@](C)(N=[N+]=[N-])[C@@H]2O1 |
| InChI | InChI=1S/C22H29N6O6PS2/c1-21(2,3)37-36-16-8-6-5-7-14(16)10-12-31-35(30)32-13-15-18(34-35)22(4,26-27-24)19(33-15)28-11-9-17(23)25-20(28)29/h5-9,11,15,18-19H,10,12-13H2,1-4H3,(H2,23,25,29)/t15-,18-,19-,22-,35?/m1/s1 |
| InChIKey | ILXCDUCHBAFEST-XHSSCIMRSA-N |
| XLogP | 5.11 |
| TPSA | 163.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|