C24H31FN5O5PS2 — CID 158516138
9-[(4aR,6R,7R,7aR)-2-[2-[2-(tert-butyldisulfanyl)phenyl]ethoxy]-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-methylpurin-6-amine (PubChem CID 158516138) has the molecular formula C24H31FN5O5PS2 and a molecular weight of 583.65 g/mol. Its IUPAC name is 9-[(4aR,6R,7R,7aR)-2-[2-[2-(tert-butyldisulfanyl)phenyl]ethoxy]-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-methylpurin-6-amine.
| Compound Name | 9-[(4aR,6R,7R,7aR)-2-[2-[2-(tert-butyldisulfanyl)phenyl]ethoxy]-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-methylpurin-6-amine |
|---|---|
| PubChem CID | 158516138 |
| Molecular Formula | C24H31FN5O5PS2 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | 9-[(4aR,6R,7R,7aR)-2-[2-[2-(tert-butyldisulfanyl)phenyl]ethoxy]-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-methylpurin-6-amine |
| SMILES | Cc1nc(N)c2ncn([C@@H]3O[C@@H]4COP(=O)(OCCc5ccccc5SSC(C)(C)C)O[C@H]4[C@@]3(C)F)c2n1 |
| InChI | InChI=1S/C24H31FN5O5PS2/c1-14-28-20(26)18-21(29-14)30(13-27-18)22-24(5,25)19-16(34-22)12-33-36(31,35-19)32-11-10-15-8-6-7-9-17(15)37-38-23(2,3)4/h6-9,13,16,19,22H,10-12H2,1-5H3,(H2,26,28,29)/t16-,19-,22-,24-,36?/m1/s1 |
| InChIKey | JCYSSJRJWNIWDQ-JXTZLMSESA-N |
| XLogP | 5.66 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|