C22H30N3O7PS2 — CID 121404666
1-[(4aR,6R,7R,7aR)-2-[2-[2-(tert-butyldisulfanyl)phenyl]ethoxy]-7-hydroxy-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-aminopyrimidin-2-one (PubChem CID 121404666) has the molecular formula C22H30N3O7PS2 and a molecular weight of 543.60 g/mol. Its IUPAC name is 1-[(4aR,6R,7R,7aR)-2-[2-[2-(tert-butyldisulfanyl)phenyl]ethoxy]-7-hydroxy-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-aminopyrimidin-2-one.
| Compound Name | 1-[(4aR,6R,7R,7aR)-2-[2-[2-(tert-butyldisulfanyl)phenyl]ethoxy]-7-hydroxy-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-aminopyrimidin-2-one |
|---|---|
| PubChem CID | 121404666 |
| Molecular Formula | C22H30N3O7PS2 |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | 1-[(4aR,6R,7R,7aR)-2-[2-[2-(tert-butyldisulfanyl)phenyl]ethoxy]-7-hydroxy-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-aminopyrimidin-2-one |
| SMILES | CC(C)(C)SSc1ccccc1CCOP1(=O)OC[C@H]2O[C@@H](n3ccc(N)nc3=O)[C@](C)(O)[C@@H]2O1 |
| InChI | InChI=1S/C22H30N3O7PS2/c1-21(2,3)35-34-16-8-6-5-7-14(16)10-12-29-33(28)30-13-15-18(32-33)22(4,27)19(31-15)25-11-9-17(23)24-20(25)26/h5-9,11,15,18-19,27H,10,12-13H2,1-4H3,(H2,23,24,26)/t15-,18-,19-,22-,33?/m1/s1 |
| InChIKey | QJOXBWCFNUAYRE-DHSQELQSSA-N |
| XLogP | 3.80 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|