C22H38ClN5O4Si2 — CID 10506333
9-[(6aS,8S,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-chloropurin-6-amine (PubChem CID 10506333) has the molecular formula C22H38ClN5O4Si2 and a molecular weight of 528.20 g/mol. Its IUPAC name is 9-[(6aS,8S,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-chloropurin-6-amine.
| Compound Name | 9-[(6aS,8S,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-chloropurin-6-amine |
|---|---|
| PubChem CID | 10506333 |
| Molecular Formula | C22H38ClN5O4Si2 |
| Molecular Weight | 528.20 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 9-[(6aS,8S,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-chloropurin-6-amine |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@@H]2O[C@H](n3cnc4c(N)nc(Cl)nc43)C[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C22H38ClN5O4Si2/c1-12(2)33(13(3)4)29-10-17-16(31-34(32-33,14(5)6)15(7)8)9-18(30-17)28-11-25-19-20(24)26-22(23)27-21(19)28/h11-18H,9-10H2,1-8H3,(H2,24,26,27)/t16-,17-,18-/m0/s1 |
| InChIKey | CCWROTYMPIHXEV-BZSNNMDCSA-N |
| XLogP | 5.31 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.20 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|