C23H41N5O4SeSi2 — CID 162465120
9-[(6aR,8R,9aS)-9-methylselanyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-amine (PubChem CID 162465120) has the molecular formula C23H41N5O4SeSi2 and a molecular weight of 586.74 g/mol. Its IUPAC name is 9-[(6aR,8R,9aS)-9-methylselanyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-amine.
| Compound Name | 9-[(6aR,8R,9aS)-9-methylselanyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-amine |
|---|---|
| PubChem CID | 162465120 |
| Molecular Formula | C23H41N5O4SeSi2 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | 9-[(6aR,8R,9aS)-9-methylselanyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-amine |
| SMILES | C[Se]C1[C@H]2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC[C@H]2O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C23H41N5O4SeSi2/c1-13(2)34(14(3)4)29-10-17-19(31-35(32-34,15(5)6)16(7)8)20(33-9)23(30-17)28-12-27-18-21(24)25-11-26-22(18)28/h11-17,19-20,23H,10H2,1-9H3,(H2,24,25,26)/t17-,19+,20?,23-/m1/s1 |
| InChIKey | ODUYQDHXOCNDRH-BVLVASOUSA-N |
| XLogP | 4.80 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|