C27H51N5O4SSi3 — CID 11479135
9-[(6aR,8R,9S,9aR)-2,2,4,4-tetra(propan-2-yl)-9-(2-trimethylsilylethylsulfanyl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-amine (PubChem CID 11479135) has the molecular formula C27H51N5O4SSi3 and a molecular weight of 626.06 g/mol. Its IUPAC name is 9-[(6aR,8R,9S,9aR)-2,2,4,4-tetra(propan-2-yl)-9-(2-trimethylsilylethylsulfanyl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-amine.
| Compound Name | 9-[(6aR,8R,9S,9aR)-2,2,4,4-tetra(propan-2-yl)-9-(2-trimethylsilylethylsulfanyl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-amine |
|---|---|
| PubChem CID | 11479135 |
| Molecular Formula | C27H51N5O4SSi3 |
| Molecular Weight | 626.06 g/mol |
| Exact Mass | 625.30 |
| IUPAC Name | 9-[(6aR,8R,9S,9aR)-2,2,4,4-tetra(propan-2-yl)-9-(2-trimethylsilylethylsulfanyl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-amine |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@@H](SCC[Si](C)(C)C)[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C27H51N5O4SSi3/c1-17(2)39(18(3)4)33-14-21-23(35-40(36-39,19(5)6)20(7)8)24(37-12-13-38(9,10)11)27(34-21)32-16-31-22-25(28)29-15-30-26(22)32/h15-21,23-24,27H,12-14H2,1-11H3,(H2,28,29,30)/t21-,23-,24+,27-/m1/s1 |
| InChIKey | PURIOYNNNUQMJA-GJGGBTFWSA-N |
| XLogP | 6.70 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.06 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|