C29H45N5O5Si2 — CID 101368462
9-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-6-phenylmethoxypurin-2-amine (PubChem CID 101368462) has the molecular formula C29H45N5O5Si2 and a molecular weight of 599.88 g/mol. Its IUPAC name is 9-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-6-phenylmethoxypurin-2-amine.
| Compound Name | 9-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-6-phenylmethoxypurin-2-amine |
|---|---|
| PubChem CID | 101368462 |
| Molecular Formula | C29H45N5O5Si2 |
| Molecular Weight | 599.88 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | 9-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-6-phenylmethoxypurin-2-amine |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](n3cnc4c(OCc5ccccc5)nc(N)nc43)C[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C29H45N5O5Si2/c1-18(2)40(19(3)4)36-16-24-23(38-41(39-40,20(5)6)21(7)8)14-25(37-24)34-17-31-26-27(34)32-29(30)33-28(26)35-15-22-12-10-9-11-13-22/h9-13,17-21,23-25H,14-16H2,1-8H3,(H2,30,32,33)/t23-,24+,25+/m0/s1 |
| InChIKey | YVBRMCCAOOJQCP-ISJGIBHGSA-N |
| XLogP | 6.23 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.88 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|