C29H46BrN5O5Si2 — CID 131700367
9-[(6aR,8R)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-8-bromo-6-phenylmethoxy-7,8-dihydropurin-2-amine (PubChem CID 131700367) has the molecular formula C29H46BrN5O5Si2 and a molecular weight of 680.79 g/mol. Its IUPAC name is 9-[(6aR,8R)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-8-bromo-6-phenylmethoxy-7,8-dihydropurin-2-amine.
| Compound Name | 9-[(6aR,8R)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-8-bromo-6-phenylmethoxy-7,8-dihydropurin-2-amine |
|---|---|
| PubChem CID | 131700367 |
| Molecular Formula | C29H46BrN5O5Si2 |
| Molecular Weight | 680.79 g/mol |
| Exact Mass | 679.22 |
| IUPAC Name | 9-[(6aR,8R)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-8-bromo-6-phenylmethoxy-7,8-dihydropurin-2-amine |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](N3c4nc(N)nc(OCc5ccccc5)c4NC3Br)CC2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C29H46BrN5O5Si2/c1-17(2)41(18(3)4)37-16-23-22(39-42(40-41,19(5)6)20(7)8)14-24(38-23)35-26-25(32-28(35)30)27(34-29(31)33-26)36-15-21-12-10-9-11-13-21/h9-13,17-20,22-24,28,32H,14-16H2,1-8H3,(H2,31,33,34)/t22?,23-,24-,28?/m1/s1 |
| InChIKey | ZQFJWUPEVONXTH-MSRUFZRRSA-N |
| XLogP | 6.62 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.79 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|