C30H44N8O6Si2 — CID 15476717
N-[9-[(6aR,8R,9R,9aR)-9-(azidomethoxy)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-yl]benzamide (PubChem CID 15476717) has the molecular formula C30H44N8O6Si2 and a molecular weight of 668.90 g/mol. Its IUPAC name is N-[9-[(6aR,8R,9R,9aR)-9-(azidomethoxy)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(6aR,8R,9R,9aR)-9-(azidomethoxy)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 15476717 |
| Molecular Formula | C30H44N8O6Si2 |
| Molecular Weight | 668.90 g/mol |
| Exact Mass | 668.29 |
| IUPAC Name | N-[9-[(6aR,8R,9R,9aR)-9-(azidomethoxy)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-yl]benzamide |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@H](OCN=[N+]=[N-])[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C30H44N8O6Si2/c1-18(2)45(19(3)4)41-14-23-25(43-46(44-45,20(5)6)21(7)8)26(40-17-35-37-31)30(42-23)38-16-34-24-27(32-15-33-28(24)38)36-29(39)22-12-10-9-11-13-22/h9-13,15-16,18-21,23,25-26,30H,14,17H2,1-8H3,(H,32,33,36,39)/t23-,25-,26-,30-/m1/s1 |
| InChIKey | WXDDKLLTSXVYPT-NYBSAPDNSA-N |
| XLogP | 6.59 |
| TPSA | 167.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.90 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|