C27H46N4O7Si2 — CID 140756272
9-[(9R,9aR)-9-(oxan-2-yloxy)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-1H-purin-6-one (PubChem CID 140756272) has the molecular formula C27H46N4O7Si2 and a molecular weight of 594.86 g/mol. Its IUPAC name is 9-[(9R,9aR)-9-(oxan-2-yloxy)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-1H-purin-6-one.
| Compound Name | 9-[(9R,9aR)-9-(oxan-2-yloxy)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 140756272 |
| Molecular Formula | C27H46N4O7Si2 |
| Molecular Weight | 594.86 g/mol |
| Exact Mass | 594.29 |
| IUPAC Name | 9-[(9R,9aR)-9-(oxan-2-yloxy)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-1H-purin-6-one |
| SMILES | CC(C)[Si]1(C(C)C)OCC2OC(n3cnc4c(=O)[nH]cnc43)[C@H](OC3CCCCO3)[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C27H46N4O7Si2/c1-16(2)39(17(3)4)34-13-20-23(37-40(38-39,18(5)6)19(7)8)24(36-21-11-9-10-12-33-21)27(35-20)31-15-30-22-25(31)28-14-29-26(22)32/h14-21,23-24,27H,9-13H2,1-8H3,(H,28,29,32)/t20?,21?,23-,24-,27?/m1/s1 |
| InChIKey | UPOWAVGTOCVCKN-LZKYLHEDSA-N |
| XLogP | 4.89 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.86 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|