C24H43N5O9SSi2 — CID 136811220
[(6aR,8R,9R,9aS)-8-(2-amino-6-oxo-1H-purin-9-yl)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6,6a,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]methyl methanesulfonate (PubChem CID 136811220) has the molecular formula C24H43N5O9SSi2 and a molecular weight of 633.87 g/mol. Its IUPAC name is [(6aR,8R,9R,9aS)-8-(2-amino-6-oxo-1H-purin-9-yl)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6,6a,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]methyl methanesulfonate.
| Compound Name | [(6aR,8R,9R,9aS)-8-(2-amino-6-oxo-1H-purin-9-yl)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6,6a,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 136811220 |
| Molecular Formula | C24H43N5O9SSi2 |
| Molecular Weight | 633.87 g/mol |
| Exact Mass | 633.23 |
| IUPAC Name | [(6aR,8R,9R,9aS)-8-(2-amino-6-oxo-1H-purin-9-yl)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6,6a,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]methyl methanesulfonate |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@](COS(C)(=O)=O)(n3cnc4c(=O)[nH]c(N)nc43)[C@H](O)[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C24H43N5O9SSi2/c1-13(2)40(14(3)4)35-10-17-19(37-41(38-40,15(5)6)16(7)8)20(30)24(36-17,11-34-39(9,32)33)29-12-26-18-21(29)27-23(25)28-22(18)31/h12-17,19-20,30H,10-11H2,1-9H3,(H3,25,27,28,31)/t17-,19-,20-,24-/m1/s1 |
| InChIKey | DASCUYNUYLAFSM-AGFSROSKSA-N |
| XLogP | 2.05 |
| TPSA | 190.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.87 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|