C12H19N6O9P — CID 137146574
[[(2S,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-5-ethyl-3,4-dihydroxyoxolan-2-yl]-aminooxymethyl] dihydrogen phosphate (PubChem CID 137146574) has the molecular formula C12H19N6O9P and a molecular weight of 422.29 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-5-ethyl-3,4-dihydroxyoxolan-2-yl]-aminooxymethyl] dihydrogen phosphate.
| Compound Name | [[(2S,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-5-ethyl-3,4-dihydroxyoxolan-2-yl]-aminooxymethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 137146574 |
| Molecular Formula | C12H19N6O9P |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | [[(2S,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-5-ethyl-3,4-dihydroxyoxolan-2-yl]-aminooxymethyl] dihydrogen phosphate |
| SMILES | CC[C@@]1(n2cnc3c(=O)[nH]c(N)nc32)O[C@H](C(ON)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H19N6O9P/c1-2-12(18-3-15-4-8(18)16-11(13)17-9(4)21)7(20)5(19)6(25-12)10(26-14)27-28(22,23)24/h3,5-7,10,19-20H,2,14H2,1H3,(H2,22,23,24)(H3,13,16,17,21)/t5-,6+,7-,10?,12-/m1/s1 |
| InChIKey | SVYLCBJUIKDIKO-WOFGMDOFSA-N |
| XLogP | -2.79 |
| TPSA | 241.29 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|