C14H23N5O11P2 — CID 166863456
[5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-2,3,4,5-tetramethyloxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 166863456) has the molecular formula C14H23N5O11P2 and a molecular weight of 499.31 g/mol. Its IUPAC name is [5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-2,3,4,5-tetramethyloxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-2,3,4,5-tetramethyloxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 166863456 |
| Molecular Formula | C14H23N5O11P2 |
| Molecular Weight | 499.31 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | [5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-2,3,4,5-tetramethyloxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | CC1(COP(=O)(O)OP(=O)(O)O)OC(C)(n2cnc3c(=O)[nH]c(N)nc32)C(C)(O)C1(C)O |
| InChI | InChI=1S/C14H23N5O11P2/c1-11(5-28-32(26,27)30-31(23,24)25)12(2,21)13(3,22)14(4,29-11)19-6-16-7-8(19)17-10(15)18-9(7)20/h6,21-22H,5H2,1-4H3,(H,26,27)(H2,23,24,25)(H3,15,17,18,20) |
| InChIKey | BVCWRKPBEMQXMP-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 252.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.31 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|