C13H19FN5O13P3 — CID 137153884
[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-fluoro-3-hydroxy-5-prop-1-en-2-yloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 137153884) has the molecular formula C13H19FN5O13P3 and a molecular weight of 565.24 g/mol. Its IUPAC name is [[5-(2-amino-6-oxo-1H-purin-9-yl)-4-fluoro-3-hydroxy-5-prop-1-en-2-yloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)-4-fluoro-3-hydroxy-5-prop-1-en-2-yloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 137153884 |
| Molecular Formula | C13H19FN5O13P3 |
| Molecular Weight | 565.24 g/mol |
| Exact Mass | 565.02 |
| IUPAC Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)-4-fluoro-3-hydroxy-5-prop-1-en-2-yloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=C(C)C1(n2cnc3c(=O)[nH]c(N)nc32)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C1F |
| InChI | InChI=1S/C13H19FN5O13P3/c1-5(2)13(19-4-16-7-10(19)17-12(15)18-11(7)21)9(14)8(20)6(30-13)3-29-34(25,26)32-35(27,28)31-33(22,23)24/h4,6,8-9,20H,1,3H2,2H3,(H,25,26)(H,27,28)(H2,22,23,24)(H3,15,17,18,21) |
| InChIKey | BZWGWWFZVOSNHP-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 278.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.24 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|