C12H15N6O14P3 — CID 136594347
[[(1R,3R,4R,7S)-3-(2-amino-6-oxo-1H-purin-9-yl)-3-cyano-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 136594347) has the molecular formula C12H15N6O14P3 and a molecular weight of 560.20 g/mol. Its IUPAC name is [[(1R,3R,4R,7S)-3-(2-amino-6-oxo-1H-purin-9-yl)-3-cyano-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1R,3R,4R,7S)-3-(2-amino-6-oxo-1H-purin-9-yl)-3-cyano-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 136594347 |
| Molecular Formula | C12H15N6O14P3 |
| Molecular Weight | 560.20 g/mol |
| Exact Mass | 559.99 |
| IUPAC Name | [[(1R,3R,4R,7S)-3-(2-amino-6-oxo-1H-purin-9-yl)-3-cyano-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | N#C[C@@]1(n2cnc3c(=O)[nH]c(N)nc32)O[C@@]2(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)CO[C@@H]1[C@@H]2O |
| InChI | InChI=1S/C12H15N6O14P3/c13-1-12(18-4-15-5-8(18)16-10(14)17-9(5)20)7-6(19)11(30-12,2-28-7)3-29-34(24,25)32-35(26,27)31-33(21,22)23/h4,6-7,19H,2-3H2,(H,24,25)(H,26,27)(H2,21,22,23)(H3,14,16,17,20)/t6-,7+,11+,12+/m0/s1 |
| InChIKey | VMNFAZAPPRTHLH-DOGNXLDXSA-N |
| XLogP | -2.25 |
| TPSA | 311.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.20 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|