C13H19N5O7 — CID 142544203
2-amino-9-[(2R,3S,4R,5R)-2-ethoxy-3,4-dihydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 142544203) has the molecular formula C13H19N5O7 and a molecular weight of 357.32 g/mol. Its IUPAC name is 2-amino-9-[(2R,3S,4R,5R)-2-ethoxy-3,4-dihydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3S,4R,5R)-2-ethoxy-3,4-dihydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 142544203 |
| Molecular Formula | C13H19N5O7 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-amino-9-[(2R,3S,4R,5R)-2-ethoxy-3,4-dihydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | CCO[C@@]1(n2cnc3c(=O)[nH]c(N)nc32)O[C@H](CO)[C@@H](O)[C@]1(O)OC |
| InChI | InChI=1S/C13H19N5O7/c1-3-24-13(12(22,23-2)8(20)6(4-19)25-13)18-5-15-7-9(18)16-11(14)17-10(7)21/h5-6,8,19-20,22H,3-4H2,1-2H3,(H3,14,16,17,21)/t6-,8-,12+,13-/m1/s1 |
| InChIKey | SYELZNXVLONXNB-AEHGZURPSA-N |
| XLogP | -2.56 |
| TPSA | 177.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|