C11H17N5O5Si — CID 151969304
2-amino-9-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-methylsilyloxolan-2-yl]-1H-purin-6-one (PubChem CID 151969304) has the molecular formula C11H17N5O5Si and a molecular weight of 327.37 g/mol. Its IUPAC name is 2-amino-9-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-methylsilyloxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-methylsilyloxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 151969304 |
| Molecular Formula | C11H17N5O5Si |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-amino-9-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-methylsilyloxolan-2-yl]-1H-purin-6-one |
| SMILES | C[SiH2][C@@]1(n2cnc3c(=O)[nH]c(N)nc32)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H17N5O5Si/c1-22-11(7(19)6(18)4(2-17)21-11)16-3-13-5-8(16)14-10(12)15-9(5)20/h3-4,6-7,17-19H,2,22H2,1H3,(H3,12,14,15,20)/t4-,6-,7-,11+/m1/s1 |
| InChIKey | UAIDEIFLJABGRM-HEIFUQTGSA-N |
| XLogP | -3.36 |
| TPSA | 159.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|