C20H27Cl2N5O6 — CID 87238424
tert-butyl N-[(1R,2R,3R,4R)-4-(2,6-dichloropurin-9-yl)-2,3-dihydroxycyclopentyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 87238424) has the molecular formula C20H27Cl2N5O6 and a molecular weight of 504.37 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R,3R,4R)-4-(2,6-dichloropurin-9-yl)-2,3-dihydroxycyclopentyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R,3R,4R)-4-(2,6-dichloropurin-9-yl)-2,3-dihydroxycyclopentyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 87238424 |
| Molecular Formula | C20H27Cl2N5O6 |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | tert-butyl N-[(1R,2R,3R,4R)-4-(2,6-dichloropurin-9-yl)-2,3-dihydroxycyclopentyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)[C@@H]1C[C@@H](n2cnc3c(Cl)nc(Cl)nc32)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H27Cl2N5O6/c1-19(2,3)32-17(30)27(18(31)33-20(4,5)6)10-7-9(12(28)13(10)29)26-8-23-11-14(21)24-16(22)25-15(11)26/h8-10,12-13,28-29H,7H2,1-6H3/t9-,10-,12-,13-/m1/s1 |
| InChIKey | DGCUKMKXWAJAAE-FPQZTECRSA-N |
| XLogP | 3.34 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |