C27H36ClN5O7 — CID 170391959
tert-butyl N-[9-[(3aS,4R,8R,8aR,8bR)-8-hydroxy-2,2-dimethyl-4,6,7,8,8a,8b-hexahydro-3aH-indeno[1,2-d][1,3]dioxol-4-yl]-6-chloropurin-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 170391959) has the molecular formula C27H36ClN5O7 and a molecular weight of 578.07 g/mol. Its IUPAC name is tert-butyl N-[9-[(3aS,4R,8R,8aR,8bR)-8-hydroxy-2,2-dimethyl-4,6,7,8,8a,8b-hexahydro-3aH-indeno[1,2-d][1,3]dioxol-4-yl]-6-chloropurin-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[9-[(3aS,4R,8R,8aR,8bR)-8-hydroxy-2,2-dimethyl-4,6,7,8,8a,8b-hexahydro-3aH-indeno[1,2-d][1,3]dioxol-4-yl]-6-chloropurin-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 170391959 |
| Molecular Formula | C27H36ClN5O7 |
| Molecular Weight | 578.07 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | tert-butyl N-[9-[(3aS,4R,8R,8aR,8bR)-8-hydroxy-2,2-dimethyl-4,6,7,8,8a,8b-hexahydro-3aH-indeno[1,2-d][1,3]dioxol-4-yl]-6-chloropurin-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1nc(Cl)c2ncn([C@@H]3C4=CCC[C@@H](O)[C@@H]4[C@H]4OC(C)(C)O[C@H]43)c2n1 |
| InChI | InChI=1S/C27H36ClN5O7/c1-25(2,3)39-23(35)33(24(36)40-26(4,5)6)22-30-20(28)16-21(31-22)32(12-29-16)17-13-10-9-11-14(34)15(13)18-19(17)38-27(7,8)37-18/h10,12,14-15,17-19,34H,9,11H2,1-8H3/t14-,15-,17-,18-,19+/m1/s1 |
| InChIKey | WZEBILJVJKXXAF-YRGVVPAESA-N |
| XLogP | 4.93 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.07 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|