C16H19N4O5P — CID 11153144
[4-hydroxy-3-(6-phenylpurin-9-yl)butoxy]methylphosphonic acid (PubChem CID 11153144) has the molecular formula C16H19N4O5P and a molecular weight of 378.33 g/mol. Its IUPAC name is [4-hydroxy-3-(6-phenylpurin-9-yl)butoxy]methylphosphonic acid.
| Compound Name | [4-hydroxy-3-(6-phenylpurin-9-yl)butoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 11153144 |
| Molecular Formula | C16H19N4O5P |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | [4-hydroxy-3-(6-phenylpurin-9-yl)butoxy]methylphosphonic acid |
| SMILES | O=P(O)(O)COCCC(CO)n1cnc2c(-c3ccccc3)ncnc21 |
| InChI | InChI=1S/C16H19N4O5P/c21-8-13(6-7-25-11-26(22,23)24)20-10-19-15-14(17-9-18-16(15)20)12-4-2-1-3-5-12/h1-5,9-10,13,21H,6-8,11H2,(H2,22,23,24) |
| InChIKey | QACNUKLVNIYKLO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|