C21H34N5O8P — CID 87775967
[2-(6-aminopurin-9-yl)butoxy-bis(2,2-dimethylpropanoyloxy)methyl]-methoxyphosphinic acid (PubChem CID 87775967) has the molecular formula C21H34N5O8P and a molecular weight of 515.50 g/mol. Its IUPAC name is [2-(6-aminopurin-9-yl)butoxy-bis(2,2-dimethylpropanoyloxy)methyl]-methoxyphosphinic acid.
| Compound Name | [2-(6-aminopurin-9-yl)butoxy-bis(2,2-dimethylpropanoyloxy)methyl]-methoxyphosphinic acid |
|---|---|
| PubChem CID | 87775967 |
| Molecular Formula | C21H34N5O8P |
| Molecular Weight | 515.50 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | [2-(6-aminopurin-9-yl)butoxy-bis(2,2-dimethylpropanoyloxy)methyl]-methoxyphosphinic acid |
| SMILES | CCC(COC(OC(=O)C(C)(C)C)(OC(=O)C(C)(C)C)P(=O)(O)OC)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C21H34N5O8P/c1-9-13(26-12-25-14-15(22)23-11-24-16(14)26)10-32-21(35(29,30)31-8,33-17(27)19(2,3)4)34-18(28)20(5,6)7/h11-13H,9-10H2,1-8H3,(H,29,30)(H2,22,23,24) |
| InChIKey | YSUIKZQMNCKBGY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 177.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|