C36H44N5O6P — CID 58657756
4-[di(propan-2-yloxy)phosphorylmethoxy]-3-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]butan-1-ol (PubChem CID 58657756) has the molecular formula C36H44N5O6P and a molecular weight of 673.75 g/mol. Its IUPAC name is 4-[di(propan-2-yloxy)phosphorylmethoxy]-3-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]butan-1-ol.
| Compound Name | 4-[di(propan-2-yloxy)phosphorylmethoxy]-3-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]butan-1-ol |
|---|---|
| PubChem CID | 58657756 |
| Molecular Formula | C36H44N5O6P |
| Molecular Weight | 673.75 g/mol |
| Exact Mass | 673.30 |
| IUPAC Name | 4-[di(propan-2-yloxy)phosphorylmethoxy]-3-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]butan-1-ol |
| SMILES | COc1ccc(C(Nc2ncnc3c2ncn3C(CCO)COCP(=O)(OC(C)C)OC(C)C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H44N5O6P/c1-26(2)46-48(43,47-27(3)4)25-45-22-31(20-21-42)41-24-39-33-34(37-23-38-35(33)41)40-36(28-12-8-6-9-13-28,29-14-10-7-11-15-29)30-16-18-32(44-5)19-17-30/h6-19,23-24,26-27,31,42H,20-22,25H2,1-5H3,(H,37,38,40) |
| InChIKey | YUXDBNNIWIAHCM-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.75 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|