C49H45N5O4 — CID 69304912
2-[(3-methoxyphenyl)-diphenylmethoxy]-2-[6-[[(2-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]butan-1-ol (PubChem CID 69304912) has the molecular formula C49H45N5O4 and a molecular weight of 767.93 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)-diphenylmethoxy]-2-[6-[[(2-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]butan-1-ol.
| Compound Name | 2-[(3-methoxyphenyl)-diphenylmethoxy]-2-[6-[[(2-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]butan-1-ol |
|---|---|
| PubChem CID | 69304912 |
| Molecular Formula | C49H45N5O4 |
| Molecular Weight | 767.93 g/mol |
| Exact Mass | 767.35 |
| IUPAC Name | 2-[(3-methoxyphenyl)-diphenylmethoxy]-2-[6-[[(2-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]butan-1-ol |
| SMILES | CCC(CO)(OC(c1ccccc1)(c1ccccc1)c1cccc(OC)c1)n1cnc2c(NC(c3ccccc3)(c3ccccc3)c3ccccc3OC)ncnc21 |
| InChI | InChI=1S/C49H45N5O4/c1-4-47(33-55,58-49(38-24-13-7-14-25-38,39-26-15-8-16-27-39)40-28-19-29-41(32-40)56-2)54-35-52-44-45(50-34-51-46(44)54)53-48(36-20-9-5-10-21-36,37-22-11-6-12-23-37)42-30-17-18-31-43(42)57-3/h5-32,34-35,55H,4,33H2,1-3H3,(H,50,51,53) |
| InChIKey | VOJKCOYJFLYNKB-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.93 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|