C49H61N5O6Si2 — CID 154415720
N-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)-2-[(3-methoxyphenyl)-diphenylmethyl]oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 154415720) has the molecular formula C49H61N5O6Si2 and a molecular weight of 872.23 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)-2-[(3-methoxyphenyl)-diphenylmethyl]oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)-2-[(3-methoxyphenyl)-diphenylmethyl]oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 154415720 |
| Molecular Formula | C49H61N5O6Si2 |
| Molecular Weight | 872.23 g/mol |
| Exact Mass | 871.42 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)-2-[(3-methoxyphenyl)-diphenylmethyl]oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1cccc(C(c2ccccc2)(c2ccccc2)[C@@]2(n3cnc4c(NC(=O)c5ccccc5)ncnc43)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C49H61N5O6Si2/c1-46(2,3)61(8,9)59-41-39(31-55)58-49(42(41)60-62(10,11)47(4,5)6,54-33-52-40-43(50-32-51-44(40)54)53-45(56)34-22-15-12-16-23-34)48(35-24-17-13-18-25-35,36-26-19-14-20-27-36)37-28-21-29-38(30-37)57-7/h12-30,32-33,39,41-42,55H,31H2,1-11H3,(H,50,51,53,56)/t39-,41-,42-,49+/m1/s1 |
| InChIKey | GAESWGRXDGRBJY-IQBYBCMISA-N |
| XLogP | 9.95 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.23 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|