C35H37N5O6 — CID 86660148
N-[9-[(2R,3R,4R,5R)-4-hydroxy-3-methoxy-5-(methylperoxymethyl)-2-trityloxolan-2-yl]purin-6-yl]butanamide (PubChem CID 86660148) has the molecular formula C35H37N5O6 and a molecular weight of 623.71 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-4-hydroxy-3-methoxy-5-(methylperoxymethyl)-2-trityloxolan-2-yl]purin-6-yl]butanamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-4-hydroxy-3-methoxy-5-(methylperoxymethyl)-2-trityloxolan-2-yl]purin-6-yl]butanamide |
|---|---|
| PubChem CID | 86660148 |
| Molecular Formula | C35H37N5O6 |
| Molecular Weight | 623.71 g/mol |
| Exact Mass | 623.27 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-4-hydroxy-3-methoxy-5-(methylperoxymethyl)-2-trityloxolan-2-yl]purin-6-yl]butanamide |
| SMILES | CCCC(=O)Nc1ncnc2c1ncn2[C@]1(C(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H](COOC)[C@@H](O)[C@H]1OC |
| InChI | InChI=1S/C35H37N5O6/c1-4-14-28(41)39-32-29-33(37-22-36-32)40(23-38-29)35(31(43-2)30(42)27(46-35)21-45-44-3)34(24-15-8-5-9-16-24,25-17-10-6-11-18-25)26-19-12-7-13-20-26/h5-13,15-20,22-23,27,30-31,42H,4,14,21H2,1-3H3,(H,36,37,39,41)/t27-,30-,31-,35+/m1/s1 |
| InChIKey | ZYUUXGPNXZKLEV-HYSDEYDMSA-N |
| XLogP | 4.61 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.71 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|