C38H33N5O7 — CID 87149754
2-[[(2R,3S,5S)-3-hydroxy-5-[6-(methoxyamino)purin-9-yl]-5-trityloxolan-2-yl]methoxycarbonyl]benzoic acid (PubChem CID 87149754) has the molecular formula C38H33N5O7 and a molecular weight of 671.71 g/mol. Its IUPAC name is 2-[[(2R,3S,5S)-3-hydroxy-5-[6-(methoxyamino)purin-9-yl]-5-trityloxolan-2-yl]methoxycarbonyl]benzoic acid.
| Compound Name | 2-[[(2R,3S,5S)-3-hydroxy-5-[6-(methoxyamino)purin-9-yl]-5-trityloxolan-2-yl]methoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 87149754 |
| Molecular Formula | C38H33N5O7 |
| Molecular Weight | 671.71 g/mol |
| Exact Mass | 671.24 |
| IUPAC Name | 2-[[(2R,3S,5S)-3-hydroxy-5-[6-(methoxyamino)purin-9-yl]-5-trityloxolan-2-yl]methoxycarbonyl]benzoic acid |
| SMILES | CONc1ncnc2c1ncn2[C@@]1(C(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H](O)[C@@H](COC(=O)c2ccccc2C(=O)O)O1 |
| InChI | InChI=1S/C38H33N5O7/c1-48-42-33-32-34(40-23-39-33)43(24-41-32)37(21-30(44)31(50-37)22-49-36(47)29-20-12-11-19-28(29)35(45)46)38(25-13-5-2-6-14-25,26-15-7-3-8-16-26)27-17-9-4-10-18-27/h2-20,23-24,30-31,44H,21-22H2,1H3,(H,45,46)(H,39,40,42)/t30-,31+,37-/m0/s1 |
| InChIKey | WRBXIQKYGILJBK-NKAWTWKPSA-N |
| XLogP | 5.19 |
| TPSA | 157.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.71 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|