C46H41N5O7 — CID 150275353
9H-fluoren-9-ylmethyl N-[9-[(2S,4S,5R)-2-[(2,3-dimethoxyphenyl)-diphenylmethyl]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]carbamate (PubChem CID 150275353) has the molecular formula C46H41N5O7 and a molecular weight of 775.86 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[9-[(2S,4S,5R)-2-[(2,3-dimethoxyphenyl)-diphenylmethyl]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[9-[(2S,4S,5R)-2-[(2,3-dimethoxyphenyl)-diphenylmethyl]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]carbamate |
|---|---|
| PubChem CID | 150275353 |
| Molecular Formula | C46H41N5O7 |
| Molecular Weight | 775.86 g/mol |
| Exact Mass | 775.30 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[9-[(2S,4S,5R)-2-[(2,3-dimethoxyphenyl)-diphenylmethyl]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]carbamate |
| SMILES | COc1cccc(C(c2ccccc2)(c2ccccc2)[C@]2(n3cnc4c(NC(=O)OCC5c6ccccc6-c6ccccc65)ncnc43)C[C@H](O)[C@@H](CO)O2)c1OC |
| InChI | InChI=1S/C46H41N5O7/c1-55-38-23-13-22-36(41(38)56-2)46(29-14-5-3-6-15-29,30-16-7-4-8-17-30)45(24-37(53)39(25-52)58-45)51-28-49-40-42(47-27-48-43(40)51)50-44(54)57-26-35-33-20-11-9-18-31(33)32-19-10-12-21-34(32)35/h3-23,27-28,35,37,39,52-53H,24-26H2,1-2H3,(H,47,48,50,54)/t37-,39+,45-/m0/s1 |
| InChIKey | GELIJYPMOBNEDN-BCUZBQPKSA-N |
| XLogP | 7.03 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.86 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|