C44H38N6O8 — CID 172762677
N-[9-[(2R,3R,4S,5R)-3-hydroxy-5-(methylperoxymethyl)-4-[(2-nitrophenyl)methoxy]-2-trityloxolan-2-yl]purin-6-yl]benzamide (PubChem CID 172762677) has the molecular formula C44H38N6O8 and a molecular weight of 778.82 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5R)-3-hydroxy-5-(methylperoxymethyl)-4-[(2-nitrophenyl)methoxy]-2-trityloxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4S,5R)-3-hydroxy-5-(methylperoxymethyl)-4-[(2-nitrophenyl)methoxy]-2-trityloxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 172762677 |
| Molecular Formula | C44H38N6O8 |
| Molecular Weight | 778.82 g/mol |
| Exact Mass | 778.28 |
| IUPAC Name | N-[9-[(2R,3R,4S,5R)-3-hydroxy-5-(methylperoxymethyl)-4-[(2-nitrophenyl)methoxy]-2-trityloxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COOC[C@H]1O[C@](n2cnc3c(NC(=O)c4ccccc4)ncnc32)(C(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H](O)[C@@H]1OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C44H38N6O8/c1-55-57-27-36-38(56-26-31-18-14-15-25-35(31)50(53)54)39(51)44(58-36,49-29-47-37-40(45-28-46-41(37)49)48-42(52)30-16-6-2-7-17-30)43(32-19-8-3-9-20-32,33-21-10-4-11-22-33)34-23-12-5-13-24-34/h2-25,28-29,36,38-39,51H,26-27H2,1H3,(H,45,46,48,52)/t36-,38-,39-,44+/m1/s1 |
| InChIKey | LWZWEDOLOFOKEN-MWBKEBGASA-N |
| XLogP | 6.60 |
| TPSA | 172.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.82 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|