C56H61N5O4Si — CID 58657761
9-[1-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)-diphenylmethoxy]pentan-3-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine (PubChem CID 58657761) has the molecular formula C56H61N5O4Si and a molecular weight of 896.22 g/mol. Its IUPAC name is 9-[1-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)-diphenylmethoxy]pentan-3-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine.
| Compound Name | 9-[1-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)-diphenylmethoxy]pentan-3-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine |
|---|---|
| PubChem CID | 58657761 |
| Molecular Formula | C56H61N5O4Si |
| Molecular Weight | 896.22 g/mol |
| Exact Mass | 895.45 |
| IUPAC Name | 9-[1-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)-diphenylmethoxy]pentan-3-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine |
| SMILES | COc1ccc(C(Nc2ncnc3c2ncn3C(CCO[Si](C)(C)C(C)(C)C)C(C)OC(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C56H61N5O4Si/c1-41(65-56(45-25-17-11-18-26-45,46-27-19-12-20-28-46)47-31-35-49(63-6)36-32-47)50(37-38-64-66(7,8)54(2,3)4)61-40-59-51-52(57-39-58-53(51)61)60-55(42-21-13-9-14-22-42,43-23-15-10-16-24-43)44-29-33-48(62-5)34-30-44/h9-36,39-41,50H,37-38H2,1-8H3,(H,57,58,60) |
| InChIKey | MXPSTRXLCZFBFZ-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.22 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|