C37H36ClN5O4 — CID 118012854
9-[(3aR,6R,6aS)-6-(chloromethyl)-6-ethyl-3a-ethynyl-2,2-dimethyl-4,6a-dihydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine (PubChem CID 118012854) has the molecular formula C37H36ClN5O4 and a molecular weight of 650.18 g/mol. Its IUPAC name is 9-[(3aR,6R,6aS)-6-(chloromethyl)-6-ethyl-3a-ethynyl-2,2-dimethyl-4,6a-dihydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine.
| Compound Name | 9-[(3aR,6R,6aS)-6-(chloromethyl)-6-ethyl-3a-ethynyl-2,2-dimethyl-4,6a-dihydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine |
|---|---|
| PubChem CID | 118012854 |
| Molecular Formula | C37H36ClN5O4 |
| Molecular Weight | 650.18 g/mol |
| Exact Mass | 649.25 |
| IUPAC Name | 9-[(3aR,6R,6aS)-6-(chloromethyl)-6-ethyl-3a-ethynyl-2,2-dimethyl-4,6a-dihydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine |
| SMILES | C#C[C@@]12OC(C)(C)O[C@@H]1[C@](CC)(CCl)OC2n1cnc2c(NC(c3ccccc3)(c3ccccc3)c3ccc(OC)cc3)ncnc21 |
| InChI | InChI=1S/C37H36ClN5O4/c1-6-35(22-38)32-36(7-2,47-34(3,4)45-32)33(46-35)43-24-41-29-30(39-23-40-31(29)43)42-37(25-14-10-8-11-15-25,26-16-12-9-13-17-26)27-18-20-28(44-5)21-19-27/h2,8-21,23-24,32-33H,6,22H2,1,3-5H3,(H,39,40,42)/t32-,33?,35+,36-/m1/s1 |
| InChIKey | MZBODHZHUZKTRI-JPTOXURKSA-N |
| XLogP | 6.68 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.18 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|