C45H47N5O2Si — CID 58657746
9-[1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine (PubChem CID 58657746) has the molecular formula C45H47N5O2Si and a molecular weight of 717.99 g/mol. Its IUPAC name is 9-[1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine.
| Compound Name | 9-[1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine |
|---|---|
| PubChem CID | 58657746 |
| Molecular Formula | C45H47N5O2Si |
| Molecular Weight | 717.99 g/mol |
| Exact Mass | 717.35 |
| IUPAC Name | 9-[1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]purin-6-amine |
| SMILES | CCC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)n1cnc2c(NC(c3ccccc3)(c3ccccc3)c3ccc(OC)cc3)ncnc21 |
| InChI | InChI=1S/C45H47N5O2Si/c1-6-37(31-52-53(44(2,3)4,39-23-15-9-16-24-39)40-25-17-10-18-26-40)50-33-48-41-42(46-32-47-43(41)50)49-45(34-19-11-7-12-20-34,35-21-13-8-14-22-35)36-27-29-38(51-5)30-28-36/h7-30,32-33,37H,6,31H2,1-5H3,(H,46,47,49) |
| InChIKey | BCXUEAOCFUJGEP-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.99 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|