C33H33N5O4 — CID 176613254
[(3aR,4R,6R,6aR)-2,2,3a-trimethyl-4-[6-(tritylamino)purin-9-yl]-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methanol (PubChem CID 176613254) has the molecular formula C33H33N5O4 and a molecular weight of 563.66 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-2,2,3a-trimethyl-4-[6-(tritylamino)purin-9-yl]-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aR,4R,6R,6aR)-2,2,3a-trimethyl-4-[6-(tritylamino)purin-9-yl]-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 176613254 |
| Molecular Formula | C33H33N5O4 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | [(3aR,4R,6R,6aR)-2,2,3a-trimethyl-4-[6-(tritylamino)purin-9-yl]-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO)O[C@@H](n3cnc4c(NC(c5ccccc5)(c5ccccc5)c5ccccc5)ncnc43)[C@]2(C)O1 |
| InChI | InChI=1S/C33H33N5O4/c1-31(2)41-27-25(19-39)40-30(32(27,3)42-31)38-21-36-26-28(34-20-35-29(26)38)37-33(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-18,20-21,25,27,30,39H,19H2,1-3H3,(H,34,35,37)/t25-,27-,30-,32-/m1/s1 |
| InChIKey | KUWRWEBPXYLICG-WYPUFXDYSA-N |
| XLogP | 5.03 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|