C16H21N5O4 — CID 126723869
[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a-prop-1-en-2-yl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methanol (PubChem CID 126723869) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a-prop-1-en-2-yl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a-prop-1-en-2-yl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 126723869 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a-prop-1-en-2-yl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methanol |
| SMILES | C=C(C)[C@@]12OC(C)(C)O[C@@H]1[C@@H](CO)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C16H21N5O4/c1-8(2)16-11(24-15(3,4)25-16)9(5-22)23-14(16)21-7-20-10-12(17)18-6-19-13(10)21/h6-7,9,11,14,22H,1,5H2,2-4H3,(H2,17,18,19)/t9-,11-,14-,16-/m1/s1 |
| InChIKey | QVCHADFRHRVQSE-ROMFRFKVSA-N |
| XLogP | 0.76 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|