C27H26N6O2 — CID 140966221
(2R)-1-[8-[[(4-methoxyphenyl)-diphenylmethyl]amino]-[1,2,4]triazolo[3,4-f][1,2,4]triazin-3-yl]propan-2-ol (PubChem CID 140966221) has the molecular formula C27H26N6O2 and a molecular weight of 466.55 g/mol. Its IUPAC name is (2R)-1-[8-[[(4-methoxyphenyl)-diphenylmethyl]amino]-[1,2,4]triazolo[3,4-f][1,2,4]triazin-3-yl]propan-2-ol.
| Compound Name | (2R)-1-[8-[[(4-methoxyphenyl)-diphenylmethyl]amino]-[1,2,4]triazolo[3,4-f][1,2,4]triazin-3-yl]propan-2-ol |
|---|---|
| PubChem CID | 140966221 |
| Molecular Formula | C27H26N6O2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | (2R)-1-[8-[[(4-methoxyphenyl)-diphenylmethyl]amino]-[1,2,4]triazolo[3,4-f][1,2,4]triazin-3-yl]propan-2-ol |
| SMILES | COc1ccc(C(Nc2ncnn3c(C[C@@H](C)O)nnc23)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H26N6O2/c1-19(34)17-24-31-32-26-25(28-18-29-33(24)26)30-27(20-9-5-3-6-10-20,21-11-7-4-8-12-21)22-13-15-23(35-2)16-14-22/h3-16,18-19,34H,17H2,1-2H3,(H,28,29,30)/t19-/m1/s1 |
| InChIKey | RCMSIKWAIDNBKA-LJQANCHMSA-N |
| XLogP | 3.86 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|