C30H31N4O5P — CID 155652914
[(2R)-1-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]propan-2-yl]oxymethylphosphonic acid (PubChem CID 155652914) has the molecular formula C30H31N4O5P and a molecular weight of 558.58 g/mol. Its IUPAC name is [(2R)-1-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]propan-2-yl]oxymethylphosphonic acid.
| Compound Name | [(2R)-1-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]propan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 155652914 |
| Molecular Formula | C30H31N4O5P |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | [(2R)-1-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]propan-2-yl]oxymethylphosphonic acid |
| SMILES | COc1ccc(C(Nc2ncnn3c(C[C@@H](C)OCP(=O)(O)O)ccc23)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H31N4O5P/c1-22(39-21-40(35,36)37)19-26-15-18-28-29(31-20-32-34(26)28)33-30(23-9-5-3-6-10-23,24-11-7-4-8-12-24)25-13-16-27(38-2)17-14-25/h3-18,20,22H,19,21H2,1-2H3,(H,31,32,33)(H2,35,36,37)/t22-/m1/s1 |
| InChIKey | DNCQDCWVWHPFPI-JOCHJYFZSA-N |
| XLogP | 5.22 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|