C26H20N4O — CID 140966206
4-(tritylamino)pyrrolo[2,1-f][1,2,4]triazine-7-carbaldehyde (PubChem CID 140966206) has the molecular formula C26H20N4O and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-(tritylamino)pyrrolo[2,1-f][1,2,4]triazine-7-carbaldehyde.
| Compound Name | 4-(tritylamino)pyrrolo[2,1-f][1,2,4]triazine-7-carbaldehyde |
|---|---|
| PubChem CID | 140966206 |
| Molecular Formula | C26H20N4O |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 4-(tritylamino)pyrrolo[2,1-f][1,2,4]triazine-7-carbaldehyde |
| SMILES | O=Cc1ccc2c(NC(c3ccccc3)(c3ccccc3)c3ccccc3)ncnn12 |
| InChI | InChI=1S/C26H20N4O/c31-18-23-16-17-24-25(27-19-28-30(23)24)29-26(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-19H,(H,27,28,29) |
| InChIKey | DCYHKIHBYROZKC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|