C31H26F3IN4O3 — CID 176760685
(2R,3R,5S)-2,4,4-trifluoro-2-(iodomethyl)-5-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-3-ol (PubChem CID 176760685) has the molecular formula C31H26F3IN4O3 and a molecular weight of 686.47 g/mol. Its IUPAC name is (2R,3R,5S)-2,4,4-trifluoro-2-(iodomethyl)-5-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-3-ol.
| Compound Name | (2R,3R,5S)-2,4,4-trifluoro-2-(iodomethyl)-5-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-3-ol |
|---|---|
| PubChem CID | 176760685 |
| Molecular Formula | C31H26F3IN4O3 |
| Molecular Weight | 686.47 g/mol |
| Exact Mass | 686.10 |
| IUPAC Name | (2R,3R,5S)-2,4,4-trifluoro-2-(iodomethyl)-5-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-3-ol |
| SMILES | COc1ccc(C(Nc2ncnn3c([C@@H]4O[C@](F)(CI)[C@@H](O)C4(F)F)ccc23)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26F3IN4O3/c1-41-23-14-12-22(13-15-23)30(20-8-4-2-5-9-20,21-10-6-3-7-11-21)38-27-25-17-16-24(39(25)37-19-36-27)26-31(33,34)28(40)29(32,18-35)42-26/h2-17,19,26,28,40H,18H2,1H3,(H,36,37,38)/t26-,28+,29+/m0/s1 |
| InChIKey | SLCFKVMHPCPUHP-WIIGKZCBSA-N |
| XLogP | 6.31 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.47 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|