C44H55BrN4O5 — CID 71135191
5-bromo-7-[(2S,3S,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-methyloxolan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 71135191) has the molecular formula C44H55BrN4O5 and a molecular weight of 799.85 g/mol. Its IUPAC name is 5-bromo-7-[(2S,3S,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-methyloxolan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-bromo-7-[(2S,3S,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-methyloxolan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 71135191 |
| Molecular Formula | C44H55BrN4O5 |
| Molecular Weight | 799.85 g/mol |
| Exact Mass | 798.34 |
| IUPAC Name | 5-bromo-7-[(2S,3S,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-methyloxolan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCCCOC[C@H]1O[C@@H](c2cc(Br)c3c(NC(c4ccccc4)(c4ccccc4)c4ccc(OC)cc4)ncnn23)[C@](C)(OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C44H55BrN4O5/c1-6-9-26-51-30-38-41(52-27-10-7-2)43(4,53-28-11-8-3)40(54-38)37-29-36(45)39-42(46-31-47-49(37)39)48-44(32-18-14-12-15-19-32,33-20-16-13-17-21-33)34-22-24-35(50-5)25-23-34/h12-25,29,31,38,40-41H,6-11,26-28,30H2,1-5H3,(H,46,47,48)/t38-,40+,41-,43+/m1/s1 |
| InChIKey | DXRBJHHAOKBNRD-XKKJWPSQSA-N |
| XLogP | 9.92 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.85 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|