C33H36N4O4 — CID 130427765
3-[4-butoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]propane-1,2-diol (PubChem CID 130427765) has the molecular formula C33H36N4O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is 3-[4-butoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]propane-1,2-diol.
| Compound Name | 3-[4-butoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 130427765 |
| Molecular Formula | C33H36N4O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 3-[4-butoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]propane-1,2-diol |
| SMILES | CCCCOc1nc(NC(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)nn2c(CC(O)CO)ccc12 |
| InChI | InChI=1S/C33H36N4O4/c1-3-4-21-41-31-30-20-17-27(22-28(39)23-38)37(30)36-32(34-31)35-33(24-11-7-5-8-12-24,25-13-9-6-10-14-25)26-15-18-29(40-2)19-16-26/h5-20,28,38-39H,3-4,21-23H2,1-2H3,(H,35,36) |
| InChIKey | XIGPQDDLRMGIFQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|