C36H34N4O3 — CID 140966225
1-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-4-phenylmethoxypyrrolo[2,1-f][1,2,4]triazin-7-yl]propan-2-ol (PubChem CID 140966225) has the molecular formula C36H34N4O3 and a molecular weight of 570.69 g/mol. Its IUPAC name is 1-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-4-phenylmethoxypyrrolo[2,1-f][1,2,4]triazin-7-yl]propan-2-ol.
| Compound Name | 1-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-4-phenylmethoxypyrrolo[2,1-f][1,2,4]triazin-7-yl]propan-2-ol |
|---|---|
| PubChem CID | 140966225 |
| Molecular Formula | C36H34N4O3 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | 1-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-4-phenylmethoxypyrrolo[2,1-f][1,2,4]triazin-7-yl]propan-2-ol |
| SMILES | COc1ccc(C(Nc2nc(OCc3ccccc3)c3ccc(CC(C)O)n3n2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H34N4O3/c1-26(41)24-31-20-23-33-34(43-25-27-12-6-3-7-13-27)37-35(39-40(31)33)38-36(28-14-8-4-9-15-28,29-16-10-5-11-17-29)30-18-21-32(42-2)22-19-30/h3-23,26,41H,24-25H2,1-2H3,(H,38,39) |
| InChIKey | YQPIPPYDKHNSQY-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|