C41H38BrN5O7 — CID 101254885
[(2R,3S,5R)-3-acetyloxy-5-[8-bromo-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-6-phenylmethoxypurin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 101254885) has the molecular formula C41H38BrN5O7 and a molecular weight of 792.69 g/mol. Its IUPAC name is [(2R,3S,5R)-3-acetyloxy-5-[8-bromo-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-6-phenylmethoxypurin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5R)-3-acetyloxy-5-[8-bromo-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-6-phenylmethoxypurin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101254885 |
| Molecular Formula | C41H38BrN5O7 |
| Molecular Weight | 792.69 g/mol |
| Exact Mass | 791.20 |
| IUPAC Name | [(2R,3S,5R)-3-acetyloxy-5-[8-bromo-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-6-phenylmethoxypurin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | COc1ccc(C(Nc2nc(OCc3ccccc3)c3nc(Br)n([C@H]4C[C@H](OC(C)=O)[C@@H](COC(C)=O)O4)c3n2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C41H38BrN5O7/c1-26(48)51-25-34-33(53-27(2)49)23-35(54-34)47-37-36(43-39(47)42)38(52-24-28-13-7-4-8-14-28)45-40(44-37)46-41(29-15-9-5-10-16-29,30-17-11-6-12-18-30)31-19-21-32(50-3)22-20-31/h4-22,33-35H,23-25H2,1-3H3,(H,44,45,46)/t33-,34+,35+/m0/s1 |
| InChIKey | KCMYBDBQEFONTJ-BMPTZRATSA-N |
| XLogP | 7.36 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.69 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|