C25H41N5O9Si2 — CID 102072045
[(2R,3S,5R)-3-acetyloxy-5-[2-(2-trimethylsilylethoxycarbonylamino)-6-(2-trimethylsilyloxyethoxy)purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 102072045) has the molecular formula C25H41N5O9Si2 and a molecular weight of 611.80 g/mol. Its IUPAC name is [(2R,3S,5R)-3-acetyloxy-5-[2-(2-trimethylsilylethoxycarbonylamino)-6-(2-trimethylsilyloxyethoxy)purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5R)-3-acetyloxy-5-[2-(2-trimethylsilylethoxycarbonylamino)-6-(2-trimethylsilyloxyethoxy)purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102072045 |
| Molecular Formula | C25H41N5O9Si2 |
| Molecular Weight | 611.80 g/mol |
| Exact Mass | 611.24 |
| IUPAC Name | [(2R,3S,5R)-3-acetyloxy-5-[2-(2-trimethylsilylethoxycarbonylamino)-6-(2-trimethylsilyloxyethoxy)purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(OCCO[Si](C)(C)C)nc(NC(=O)OCC[Si](C)(C)C)nc32)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H41N5O9Si2/c1-16(31)36-14-19-18(38-17(2)32)13-20(39-19)30-15-26-21-22(30)27-24(29-25(33)35-11-12-40(3,4)5)28-23(21)34-9-10-37-41(6,7)8/h15,18-20H,9-14H2,1-8H3,(H,27,28,29,33)/t18-,19+,20+/m0/s1 |
| InChIKey | UICBNWSIUKGOHX-XUVXKRRUSA-N |
| XLogP | 3.73 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.80 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|