C52H47N5O5 — CID 53400836
5-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-6-phenylmethoxypurin-9-yl]-3-phenylmethoxy-2-(phenylmethoxymethyl)cyclopentan-1-one (PubChem CID 53400836) has the molecular formula C52H47N5O5 and a molecular weight of 821.98 g/mol. Its IUPAC name is 5-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-6-phenylmethoxypurin-9-yl]-3-phenylmethoxy-2-(phenylmethoxymethyl)cyclopentan-1-one.
| Compound Name | 5-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-6-phenylmethoxypurin-9-yl]-3-phenylmethoxy-2-(phenylmethoxymethyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 53400836 |
| Molecular Formula | C52H47N5O5 |
| Molecular Weight | 821.98 g/mol |
| Exact Mass | 821.36 |
| IUPAC Name | 5-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-6-phenylmethoxypurin-9-yl]-3-phenylmethoxy-2-(phenylmethoxymethyl)cyclopentan-1-one |
| SMILES | COc1ccc(C(Nc2nc(OCc3ccccc3)c3ncn(C4CC(OCc5ccccc5)C(COCc5ccccc5)C4=O)c3n2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C52H47N5O5/c1-59-43-29-27-42(28-30-43)52(40-23-13-5-14-24-40,41-25-15-6-16-26-41)56-51-54-49-47(50(55-51)62-34-39-21-11-4-12-22-39)53-36-57(49)45-31-46(61-33-38-19-9-3-10-20-38)44(48(45)58)35-60-32-37-17-7-2-8-18-37/h2-30,36,44-46H,31-35H2,1H3,(H,54,55,56) |
| InChIKey | JBDUMGNQMZHOMS-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.98 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|